C24H26ClNO4 — CID 10137386
2-[3-[2-[(2R)-2-[(E,3S)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]phenyl]acetic acid (PubChem CID 10137386) has the molecular formula C24H26ClNO4 and a molecular weight of 427.93 g/mol. Its IUPAC name is 2-[3-[2-[(2R)-2-[(E,3S)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]phenyl]acetic acid.
| Compound Name | 2-[3-[2-[(2R)-2-[(E,3S)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 10137386 |
| Molecular Formula | C24H26ClNO4 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-[3-[2-[(2R)-2-[(E,3S)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(CCN2C(=O)CC[C@@H]2/C=C/[C@@H](O)Cc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C24H26ClNO4/c25-20-6-2-5-19(14-20)15-22(27)9-7-21-8-10-23(28)26(21)12-11-17-3-1-4-18(13-17)16-24(29)30/h1-7,9,13-14,21-22,27H,8,10-12,15-16H2,(H,29,30)/b9-7+/t21-,22+/m0/s1 |
| InChIKey | UWSCJMNTBCHLKW-ORMBLBCUSA-N |
| XLogP | 3.66 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|