About 3-(4-chlorophenyl)-2-ethoxy-2-oxo-1,2λ5-benzoxaphosphinin-4-ol
3-(4-chlorophenyl)-2-ethoxy-2-oxo-1,2λ5-benzoxaphosphinin-4-ol (PubChem CID 101373983) has the molecular formula C16H14ClO4P
and a molecular weight of 336.71 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-ethoxy-2-oxo-1,2λ5-benzoxaphosphinin-4-ol.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-2-ethoxy-2-oxo-1,2λ5-benzoxaphosphinin-4-ol |
| PubChem CID | 101373983 |
| Molecular Formula | C16H14ClO4P |
| Molecular Weight | 336.71 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 3-(4-chlorophenyl)-2-ethoxy-2-oxo-1,2λ5-benzoxaphosphinin-4-ol |
| SMILES | CCOP1(=O)Oc2ccccc2C(O)=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClO4P/c1-2-20-22(19)16(11-7-9-12(17)10-8-11)15(18)13-5-3-4-6-14(13)21-22/h3-10,18H,2H2,1H3 |
| InChIKey | FQVKPJYIJROIIJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.71 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chlorophenyl)-2-ethoxy-2-oxo-1,2λ5-benzoxaphosphinin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-2-ethoxy-2-oxo-1,2λ5-benzoxaphosphinin-4-ol?
The IUPAC name of 3-(4-chlorophenyl)-2-ethoxy-2-oxo-1,2λ5-benzoxaphosphinin-4-ol (CID 101373983) is 3-(4-chlorophenyl)-2-ethoxy-2-oxo-1,2λ5-benzoxaphosphinin-4-ol.
What is the SMILES notation for 3-(4-chlorophenyl)-2-ethoxy-2-oxo-1,2λ5-benzoxaphosphinin-4-ol?
The canonical SMILES for 3-(4-chlorophenyl)-2-ethoxy-2-oxo-1,2λ5-benzoxaphosphinin-4-ol is CCOP1(=O)Oc2ccccc2C(O)=C1c1ccc(Cl)cc1.
What is the InChIKey of 3-(4-chlorophenyl)-2-ethoxy-2-oxo-1,2λ5-benzoxaphosphinin-4-ol?
The InChIKey is FQVKPJYIJROIIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClO4P/c1-2-20-22(19)16(11-7-9-12(17)10-8-11)15(18)13-5-3-4-6-14(13)21-22/h3-10,18H,2H2,1H3.
What are the key properties of 3-(4-chlorophenyl)-2-ethoxy-2-oxo-1,2λ5-benzoxaphosphinin-4-ol?
3-(4-chlorophenyl)-2-ethoxy-2-oxo-1,2λ5-benzoxaphosphinin-4-ol has a molecular weight of 336.71 g/mol, XLogP of 5.35, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-2-ethoxy-2-oxo-1,2λ5-benzoxaphosphinin-4-ol is sourced from PubChem (CID 101373983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).