About (3R,5S)-3-ethyl-5-methyl-3,5-diphenylpyrazol-4-one
(3R,5S)-3-ethyl-5-methyl-3,5-diphenylpyrazol-4-one (PubChem CID 101374224) has the molecular formula C18H18N2O
and a molecular weight of 278.36 g/mol. Its IUPAC name is (3R,5S)-3-ethyl-5-methyl-3,5-diphenylpyrazol-4-one.
Molecular Properties
| Compound Name | (3R,5S)-3-ethyl-5-methyl-3,5-diphenylpyrazol-4-one |
| PubChem CID | 101374224 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (3R,5S)-3-ethyl-5-methyl-3,5-diphenylpyrazol-4-one |
| SMILES | CC[C@]1(c2ccccc2)N=N[C@@](C)(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H18N2O/c1-3-18(15-12-8-5-9-13-15)16(21)17(2,19-20-18)14-10-6-4-7-11-14/h4-13H,3H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | OSZMCHOZRWPKQL-ZWKOTPCHSA-N |
| XLogP | 4.24 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,5S)-3-ethyl-5-methyl-3,5-diphenylpyrazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5S)-3-ethyl-5-methyl-3,5-diphenylpyrazol-4-one?
The IUPAC name of (3R,5S)-3-ethyl-5-methyl-3,5-diphenylpyrazol-4-one (CID 101374224) is (3R,5S)-3-ethyl-5-methyl-3,5-diphenylpyrazol-4-one.
What is the SMILES notation for (3R,5S)-3-ethyl-5-methyl-3,5-diphenylpyrazol-4-one?
The canonical SMILES for (3R,5S)-3-ethyl-5-methyl-3,5-diphenylpyrazol-4-one is CC[C@]1(c2ccccc2)N=N[C@@](C)(c2ccccc2)C1=O.
What is the InChIKey of (3R,5S)-3-ethyl-5-methyl-3,5-diphenylpyrazol-4-one?
The InChIKey is OSZMCHOZRWPKQL-ZWKOTPCHSA-N. The full InChI is InChI=1S/C18H18N2O/c1-3-18(15-12-8-5-9-13-15)16(21)17(2,19-20-18)14-10-6-4-7-11-14/h4-13H,3H2,1-2H3/t17-,18+/m0/s1.
What are the key properties of (3R,5S)-3-ethyl-5-methyl-3,5-diphenylpyrazol-4-one?
(3R,5S)-3-ethyl-5-methyl-3,5-diphenylpyrazol-4-one has a molecular weight of 278.36 g/mol, XLogP of 4.24, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5S)-3-ethyl-5-methyl-3,5-diphenylpyrazol-4-one is sourced from PubChem (CID 101374224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).