C10H20AsO9S- — CID 101374313
3-[(2R,3R,4S,5S)-5-(dimethylarsorylmethyl)-3,4-dihydroxyoxolan-2-yl]oxy-2-hydroxypropane-1-sulfonate (PubChem CID 101374313) has the molecular formula C10H20AsO9S- and a molecular weight of 391.25 g/mol. Its IUPAC name is 3-[(2R,3R,4S,5S)-5-(dimethylarsorylmethyl)-3,4-dihydroxyoxolan-2-yl]oxy-2-hydroxypropane-1-sulfonate.
| Compound Name | 3-[(2R,3R,4S,5S)-5-(dimethylarsorylmethyl)-3,4-dihydroxyoxolan-2-yl]oxy-2-hydroxypropane-1-sulfonate |
|---|---|
| PubChem CID | 101374313 |
| Molecular Formula | C10H20AsO9S- |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | 3-[(2R,3R,4S,5S)-5-(dimethylarsorylmethyl)-3,4-dihydroxyoxolan-2-yl]oxy-2-hydroxypropane-1-sulfonate |
| SMILES | C[As](C)(=O)C[C@H]1O[C@@H](OCC(O)CS(=O)(=O)[O-])[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H21AsO9S/c1-11(2,15)3-7-8(13)9(14)10(20-7)19-4-6(12)5-21(16,17)18/h6-10,12-14H,3-5H2,1-2H3,(H,16,17,18)/p-1/t6?,7-,8-,9-,10-/m1/s1 |
| InChIKey | KSWXPPREIUKIQL-BHRXDNSCSA-M |
| XLogP | -2.01 |
| TPSA | 153.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|