C40H32Cl2N8O6 — CID 101374336
4-chloro-3-[[1-[4-[[2-[[2-chloro-5-(phenylcarbamoyl)phenyl]diazenyl]-3-oxobutanoyl]amino]anilino]-1,3-dioxobutan-2-yl]diazenyl]-N-phenylbenzamide (PubChem CID 101374336) has the molecular formula C40H32Cl2N8O6 and a molecular weight of 791.65 g/mol. Its IUPAC name is 4-chloro-3-[[1-[4-[[2-[[2-chloro-5-(phenylcarbamoyl)phenyl]diazenyl]-3-oxobutanoyl]amino]anilino]-1,3-dioxobutan-2-yl]diazenyl]-N-phenylbenzamide.
| Compound Name | 4-chloro-3-[[1-[4-[[2-[[2-chloro-5-(phenylcarbamoyl)phenyl]diazenyl]-3-oxobutanoyl]amino]anilino]-1,3-dioxobutan-2-yl]diazenyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 101374336 |
| Molecular Formula | C40H32Cl2N8O6 |
| Molecular Weight | 791.65 g/mol |
| Exact Mass | 790.18 |
| IUPAC Name | 4-chloro-3-[[1-[4-[[2-[[2-chloro-5-(phenylcarbamoyl)phenyl]diazenyl]-3-oxobutanoyl]amino]anilino]-1,3-dioxobutan-2-yl]diazenyl]-N-phenylbenzamide |
| SMILES | CC(=O)C(/N=N/c1cc(C(=O)Nc2ccccc2)ccc1Cl)C(=O)Nc1ccc(NC(=O)C(/N=N/c2cc(C(=O)Nc3ccccc3)ccc2Cl)C(C)=O)cc1 |
| InChI | InChI=1S/C40H32Cl2N8O6/c1-23(51)35(49-47-33-21-25(13-19-31(33)41)37(53)43-27-9-5-3-6-10-27)39(55)45-29-15-17-30(18-16-29)46-40(56)36(24(2)52)50-48-34-22-26(14-20-32(34)42)38(54)44-28-11-7-4-8-12-28/h3-22,35-36H,1-2H3,(H,43,53)(H,44,54)(H,45,55)(H,46,56)/b49-47+,50-48+ |
| InChIKey | BXKCMNKSTCEVDZ-RYZURTRPSA-N |
| XLogP | 8.86 |
| TPSA | 199.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.65 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|