C27H32O2SSi — CID 101374477
S-phenyl 5-[tert-butyl(diphenyl)silyl]oxypentanethioate (PubChem CID 101374477) has the molecular formula C27H32O2SSi and a molecular weight of 448.70 g/mol. Its IUPAC name is S-phenyl 5-[tert-butyl(diphenyl)silyl]oxypentanethioate.
| Compound Name | S-phenyl 5-[tert-butyl(diphenyl)silyl]oxypentanethioate |
|---|---|
| PubChem CID | 101374477 |
| Molecular Formula | C27H32O2SSi |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | S-phenyl 5-[tert-butyl(diphenyl)silyl]oxypentanethioate |
| SMILES | CC(C)(C)[Si](OCCCCC(=O)Sc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H32O2SSi/c1-27(2,3)31(24-17-9-5-10-18-24,25-19-11-6-12-20-25)29-22-14-13-21-26(28)30-23-15-7-4-8-16-23/h4-12,15-20H,13-14,21-22H2,1-3H3 |
| InChIKey | UVHNMTVKGGGDGG-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|