C20H12N2O6 — CID 101374827
2,3-bis(4-cyanobenzoyl)butanedioic acid (PubChem CID 101374827) has the molecular formula C20H12N2O6 and a molecular weight of 376.32 g/mol. Its IUPAC name is 2,3-bis(4-cyanobenzoyl)butanedioic acid.
| Compound Name | 2,3-bis(4-cyanobenzoyl)butanedioic acid |
|---|---|
| PubChem CID | 101374827 |
| Molecular Formula | C20H12N2O6 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 2,3-bis(4-cyanobenzoyl)butanedioic acid |
| SMILES | N#Cc1ccc(C(=O)C(C(=O)O)C(C(=O)O)C(=O)c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C20H12N2O6/c21-9-11-1-5-13(6-2-11)17(23)15(19(25)26)16(20(27)28)18(24)14-7-3-12(10-22)4-8-14/h1-8,15-16H,(H,25,26)(H,27,28) |
| InChIKey | YFLBYWSFRKNSBI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 156.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|