2,3-bis(4-cyanobenzoyl)butanedioic acid

C20H12N2O6 — CID 101374827

IUPAC2,3-bis(4-cyanobenzoyl)butanedioic acid
SMILESN#Cc1ccc(C(=O)C(C(=O)O)C(C(=O)O)C(=O)c2ccc(C#N)cc2)cc1
InChIInChI=1S/C20H12N2O6/c21-9-11-1-5-13(6-2-11)17(23)15(19(25)26)16(20(27)28)18(24)14-7-3-12(10-22)4-8-14/h1-8,15-16H,(H,25,26)(H,27,28)
InChIKeyYFLBYWSFRKNSBI-UHFFFAOYSA-N
MW376.32 g/mol
LogP1.90
Rot. Bonds7

About 2,3-bis(4-cyanobenzoyl)butanedioic acid

2,3-bis(4-cyanobenzoyl)butanedioic acid (PubChem CID 101374827) has the molecular formula C20H12N2O6 and a molecular weight of 376.32 g/mol. Its IUPAC name is 2,3-bis(4-cyanobenzoyl)butanedioic acid.

Molecular Properties

Compound Name2,3-bis(4-cyanobenzoyl)butanedioic acid
PubChem CID101374827
Molecular FormulaC20H12N2O6
Molecular Weight376.32 g/mol
Exact Mass376.07
IUPAC Name2,3-bis(4-cyanobenzoyl)butanedioic acid
SMILESN#Cc1ccc(C(=O)C(C(=O)O)C(C(=O)O)C(=O)c2ccc(C#N)cc2)cc1
InChIInChI=1S/C20H12N2O6/c21-9-11-1-5-13(6-2-11)17(23)15(19(25)26)16(20(27)28)18(24)14-7-3-12(10-22)4-8-14/h1-8,15-16H,(H,25,26)(H,27,28)
InChIKeyYFLBYWSFRKNSBI-UHFFFAOYSA-N
XLogP1.90
TPSA156.32 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms28
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500376.32
LogP ≤ 51.90
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2,3-bis(4-cyanobenzoyl)butanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-bis(4-cyanobenzoyl)butanedioic acid?
The IUPAC name of 2,3-bis(4-cyanobenzoyl)butanedioic acid (CID 101374827) is 2,3-bis(4-cyanobenzoyl)butanedioic acid.
What is the SMILES notation for 2,3-bis(4-cyanobenzoyl)butanedioic acid?
The canonical SMILES for 2,3-bis(4-cyanobenzoyl)butanedioic acid is N#Cc1ccc(C(=O)C(C(=O)O)C(C(=O)O)C(=O)c2ccc(C#N)cc2)cc1.
What is the InChIKey of 2,3-bis(4-cyanobenzoyl)butanedioic acid?
The InChIKey is YFLBYWSFRKNSBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12N2O6/c21-9-11-1-5-13(6-2-11)17(23)15(19(25)26)16(20(27)28)18(24)14-7-3-12(10-22)4-8-14/h1-8,15-16H,(H,25,26)(H,27,28).
What are the key properties of 2,3-bis(4-cyanobenzoyl)butanedioic acid?
2,3-bis(4-cyanobenzoyl)butanedioic acid has a molecular weight of 376.32 g/mol, XLogP of 1.90, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(4-cyanobenzoyl)butanedioic acid is sourced from PubChem (CID 101374827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).