C26H23NO5 — CID 10137483
2-[(2-benzyl-1-benzofuran-5-yl)methoxycarbonylamino]-3-phenylpropanoic acid (PubChem CID 10137483) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is 2-[(2-benzyl-1-benzofuran-5-yl)methoxycarbonylamino]-3-phenylpropanoic acid.
| Compound Name | 2-[(2-benzyl-1-benzofuran-5-yl)methoxycarbonylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 10137483 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-[(2-benzyl-1-benzofuran-5-yl)methoxycarbonylamino]-3-phenylpropanoic acid |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)O)OCc1ccc2oc(Cc3ccccc3)cc2c1 |
| InChI | InChI=1S/C26H23NO5/c28-25(29)23(15-19-9-5-2-6-10-19)27-26(30)31-17-20-11-12-24-21(13-20)16-22(32-24)14-18-7-3-1-4-8-18/h1-13,16,23H,14-15,17H2,(H,27,30)(H,28,29) |
| InChIKey | GIVBTZSMXZFGBI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |