About CID 101375049
CID 101375049 (PubChem CID 101375049) has the molecular formula C17H31OSi
and a molecular weight of 279.52 g/mol.
Molecular Properties
| Compound Name | CID 101375049 |
| PubChem CID | 101375049 |
| Molecular Formula | C17H31OSi |
| Molecular Weight | 279.52 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | — |
| SMILES | C=CCCC[C](C#CCCCCCC)O[Si](C)(C)C |
| InChI | InChI=1S/C17H31OSi/c1-6-8-10-11-12-14-16-17(15-13-9-7-2)18-19(3,4)5/h7H,2,6,8-13,15H2,1,3-5H3 |
| InChIKey | DWVLUGLUCAREHC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 279.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 101375049 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101375049?
The IUPAC name of CID 101375049 (CID 101375049) is not available.
What is the SMILES notation for CID 101375049?
The canonical SMILES for CID 101375049 is C=CCCC[C](C#CCCCCCC)O[Si](C)(C)C.
What is the InChIKey of CID 101375049?
The InChIKey is DWVLUGLUCAREHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31OSi/c1-6-8-10-11-12-14-16-17(15-13-9-7-2)18-19(3,4)5/h7H,2,6,8-13,15H2,1,3-5H3.
What are the key properties of CID 101375049?
CID 101375049 has a molecular weight of 279.52 g/mol, XLogP of 5.70, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101375049 is sourced from PubChem (CID 101375049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).