C12H20O4 — CID 101375364
(1S,3S,4S,6S)-1,3,4,6-tetramethoxy-1,2,3,4,5,6-hexahydropentalene (PubChem CID 101375364) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is (1S,3S,4S,6S)-1,3,4,6-tetramethoxy-1,2,3,4,5,6-hexahydropentalene.
| Compound Name | (1S,3S,4S,6S)-1,3,4,6-tetramethoxy-1,2,3,4,5,6-hexahydropentalene |
|---|---|
| PubChem CID | 101375364 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (1S,3S,4S,6S)-1,3,4,6-tetramethoxy-1,2,3,4,5,6-hexahydropentalene |
| SMILES | CO[C@H]1C[C@H](OC)C2=C1[C@@H](OC)C[C@@H]2OC |
| InChI | InChI=1S/C12H20O4/c1-13-7-5-8(14-2)12-10(16-4)6-9(15-3)11(7)12/h7-10H,5-6H2,1-4H3/t7-,8-,9-,10-/m0/s1 |
| InChIKey | OONOULLSPUKNPZ-XKNYDFJKSA-N |
| XLogP | 1.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|