C35H58O6Si — CID 101375475
ethyl (2Z,4E,7S,8E,10Z)-7-[tert-butyl(dimethyl)silyl]oxy-12-[(4S,6R)-6-[(1E,3E,8R)-8-hydroxynona-1,3-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]dodeca-2,4,8,10-tetraenoate (PubChem CID 101375475) has the molecular formula C35H58O6Si and a molecular weight of 602.93 g/mol. Its IUPAC name is ethyl (2Z,4E,7S,8E,10Z)-7-[tert-butyl(dimethyl)silyl]oxy-12-[(4S,6R)-6-[(1E,3E,8R)-8-hydroxynona-1,3-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]dodeca-2,4,8,10-tetraenoate.
| Compound Name | ethyl (2Z,4E,7S,8E,10Z)-7-[tert-butyl(dimethyl)silyl]oxy-12-[(4S,6R)-6-[(1E,3E,8R)-8-hydroxynona-1,3-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]dodeca-2,4,8,10-tetraenoate |
|---|---|
| PubChem CID | 101375475 |
| Molecular Formula | C35H58O6Si |
| Molecular Weight | 602.93 g/mol |
| Exact Mass | 602.40 |
| IUPAC Name | ethyl (2Z,4E,7S,8E,10Z)-7-[tert-butyl(dimethyl)silyl]oxy-12-[(4S,6R)-6-[(1E,3E,8R)-8-hydroxynona-1,3-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]dodeca-2,4,8,10-tetraenoate |
| SMILES | CCOC(=O)/C=C\C=C\C[C@@H](/C=C/C=C\C[C@H]1C[C@H](/C=C/C=C/CCC[C@@H](C)O)OC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H58O6Si/c1-10-38-33(37)27-21-15-19-24-30(41-42(8,9)34(3,4)5)23-18-14-20-26-32-28-31(39-35(6,7)40-32)25-17-13-11-12-16-22-29(2)36/h11,13-15,17-21,23,25,27,29-32,36H,10,12,16,22,24,26,28H2,1-9H3/b13-11+,19-15+,20-14-,23-18+,25-17+,27-21-/t29-,30-,31+,32+/m1/s1 |
| InChIKey | LAYBTUNHWSQYRL-PBRXCVJUSA-N |
| XLogP | 8.52 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.93 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|