C23H22N6OS — CID 10137566
2-phenyl-1-(4-pyridin-2-ylpiperazin-1-yl)-2-(4-sulfanylidene-1H-pyrazolo[4,5-c]pyridin-5-yl)ethanone (PubChem CID 10137566) has the molecular formula C23H22N6OS and a molecular weight of 430.54 g/mol. Its IUPAC name is 2-phenyl-1-(4-pyridin-2-ylpiperazin-1-yl)-2-(4-sulfanylidene-1H-pyrazolo[4,5-c]pyridin-5-yl)ethanone.
| Compound Name | 2-phenyl-1-(4-pyridin-2-ylpiperazin-1-yl)-2-(4-sulfanylidene-1H-pyrazolo[4,5-c]pyridin-5-yl)ethanone |
|---|---|
| PubChem CID | 10137566 |
| Molecular Formula | C23H22N6OS |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 2-phenyl-1-(4-pyridin-2-ylpiperazin-1-yl)-2-(4-sulfanylidene-1H-pyrazolo[4,5-c]pyridin-5-yl)ethanone |
| SMILES | O=C(C(c1ccccc1)n1ccc2[nH]ncc2c1=S)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C23H22N6OS/c30-22(28-14-12-27(13-15-28)20-8-4-5-10-24-20)21(17-6-2-1-3-7-17)29-11-9-19-18(23(29)31)16-25-26-19/h1-11,16,21H,12-15H2,(H,25,26) |
| InChIKey | FIVRTVDZLXWIKR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|