About 7-ethoxy-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine
7-ethoxy-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine (PubChem CID 101375966) has the molecular formula C7H11N3O2
and a molecular weight of 169.18 g/mol. Its IUPAC name is 7-ethoxy-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine.
Analyze 7-ethoxy-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethoxy-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine?
The IUPAC name of 7-ethoxy-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine (CID 101375966) is 7-ethoxy-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine.
What is the SMILES notation for 7-ethoxy-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine?
The canonical SMILES for 7-ethoxy-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine is CCOC1COCc2cnnn21.
What is the InChIKey of 7-ethoxy-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine?
The InChIKey is LIYFQPYYABKRER-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2/c1-2-12-7-5-11-4-6-3-8-9-10(6)7/h3,7H,2,4-5H2,1H3.
What are the key properties of 7-ethoxy-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine?
7-ethoxy-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine has a molecular weight of 169.18 g/mol, XLogP of 0.34, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethoxy-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine is sourced from PubChem (CID 101375966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).