C16H19NO2 — CID 101375980
1-[(3S,8aR)-5-methyl-3-phenyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-6-yl]ethanone (PubChem CID 101375980) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 1-[(3S,8aR)-5-methyl-3-phenyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-6-yl]ethanone.
| Compound Name | 1-[(3S,8aR)-5-methyl-3-phenyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-6-yl]ethanone |
|---|---|
| PubChem CID | 101375980 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 1-[(3S,8aR)-5-methyl-3-phenyl-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-6-yl]ethanone |
| SMILES | CC(=O)C1=C(C)N2[C@@H](c3ccccc3)CO[C@@H]2CC1 |
| InChI | InChI=1S/C16H19NO2/c1-11-14(12(2)18)8-9-16-17(11)15(10-19-16)13-6-4-3-5-7-13/h3-7,15-16H,8-10H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | YDJJGKUFHRLTDI-HZPDHXFCSA-N |
| XLogP | 3.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |