C36H84Br2Si8 — CID 101376613
ditert-butyl-[(1S,2S)-1,2-dibromo-2,3,4-tris[ditert-butyl(methyl)silyl]tetrasilet-1-yl]-methylsilane (PubChem CID 101376613) has the molecular formula C36H84Br2Si8 and a molecular weight of 901.56 g/mol. Its IUPAC name is ditert-butyl-[(1S,2S)-1,2-dibromo-2,3,4-tris[ditert-butyl(methyl)silyl]tetrasilet-1-yl]-methylsilane.
| Compound Name | ditert-butyl-[(1S,2S)-1,2-dibromo-2,3,4-tris[ditert-butyl(methyl)silyl]tetrasilet-1-yl]-methylsilane |
|---|---|
| PubChem CID | 101376613 |
| Molecular Formula | C36H84Br2Si8 |
| Molecular Weight | 901.56 g/mol |
| Exact Mass | 898.31 |
| IUPAC Name | ditert-butyl-[(1S,2S)-1,2-dibromo-2,3,4-tris[ditert-butyl(methyl)silyl]tetrasilet-1-yl]-methylsilane |
| SMILES | CC(C)(C)[Si](C)([Si]1=[Si]([Si](C)(C(C)(C)C)C(C)(C)C)[Si@@](Br)([Si](C)(C(C)(C)C)C(C)(C)C)[Si@]1(Br)[Si](C)(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C36H84Br2Si8/c1-29(2,3)41(25,30(4,5)6)39-40(42(26,31(7,8)9)32(10,11)12)46(38,44(28,35(19,20)21)36(22,23)24)45(39,37)43(27,33(13,14)15)34(16,17)18/h1-28H3/t45-,46-/m0/s1 |
| InChIKey | LOYPOYLPOCJQJP-ZYBCLOSLSA-N |
| XLogP | 15.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.56 |
| LogP ≤ 5 | 15.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|