C34H34F3N2O+ — CID 101376615
4-[(R)-[(1S,2S,4S,5R)-5-ethenyl-1-[[4-(trifluoromethyl)phenyl]methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]quinoline (PubChem CID 101376615) has the molecular formula C34H34F3N2O+ and a molecular weight of 543.65 g/mol. Its IUPAC name is 4-[(R)-[(1S,2S,4S,5R)-5-ethenyl-1-[[4-(trifluoromethyl)phenyl]methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]quinoline.
| Compound Name | 4-[(R)-[(1S,2S,4S,5R)-5-ethenyl-1-[[4-(trifluoromethyl)phenyl]methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]quinoline |
|---|---|
| PubChem CID | 101376615 |
| Molecular Formula | C34H34F3N2O+ |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | 4-[(R)-[(1S,2S,4S,5R)-5-ethenyl-1-[[4-(trifluoromethyl)phenyl]methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]quinoline |
| SMILES | C=C[C@H]1C[N@+]2(Cc3ccc(C(F)(F)F)cc3)CC[C@H]1C[C@H]2[C@H](OCc1ccccc1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C34H34F3N2O/c1-2-26-22-39(21-24-12-14-28(15-13-24)34(35,36)37)19-17-27(26)20-32(39)33(40-23-25-8-4-3-5-9-25)30-16-18-38-31-11-7-6-10-29(30)31/h2-16,18,26-27,32-33H,1,17,19-23H2/q+1/t26-,27-,32-,33+,39+/m0/s1 |
| InChIKey | HJVXVJGOAIEBLV-QEJKWZLYSA-N |
| XLogP | 8.12 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|