C19H34F3NO4Si — CID 101376667
tert-butyl (E,2S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]hept-4-enoate (PubChem CID 101376667) has the molecular formula C19H34F3NO4Si and a molecular weight of 425.56 g/mol. Its IUPAC name is tert-butyl (E,2S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]hept-4-enoate.
| Compound Name | tert-butyl (E,2S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]hept-4-enoate |
|---|---|
| PubChem CID | 101376667 |
| Molecular Formula | C19H34F3NO4Si |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | tert-butyl (E,2S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]hept-4-enoate |
| SMILES | C[C@@H](/C=C/C[C@H](NC(=O)C(F)(F)F)C(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34F3NO4Si/c1-13(27-28(8,9)18(5,6)7)11-10-12-14(15(24)26-17(2,3)4)23-16(25)19(20,21)22/h10-11,13-14H,12H2,1-9H3,(H,23,25)/b11-10+/t13-,14-/m0/s1 |
| InChIKey | RLOQHMMUCNTHPV-NKVPIJFCSA-N |
| XLogP | 4.73 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|