C26H38O6Si — CID 101377042
(2R,4S,6E,8E,10E)-7-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxy-5-methylidene-2-oxofuran-3-yl)-2,4-dimethyldodeca-6,8,10-triene-1,5-dione (PubChem CID 101377042) has the molecular formula C26H38O6Si and a molecular weight of 474.67 g/mol. Its IUPAC name is (2R,4S,6E,8E,10E)-7-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxy-5-methylidene-2-oxofuran-3-yl)-2,4-dimethyldodeca-6,8,10-triene-1,5-dione.
| Compound Name | (2R,4S,6E,8E,10E)-7-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxy-5-methylidene-2-oxofuran-3-yl)-2,4-dimethyldodeca-6,8,10-triene-1,5-dione |
|---|---|
| PubChem CID | 101377042 |
| Molecular Formula | C26H38O6Si |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | (2R,4S,6E,8E,10E)-7-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxy-5-methylidene-2-oxofuran-3-yl)-2,4-dimethyldodeca-6,8,10-triene-1,5-dione |
| SMILES | C=C1OC(=O)C(C(=O)[C@H](C)C[C@H](C)C(=O)/C=C(\C=C\C=C\C)O[Si](C)(C)C(C)(C)C)=C1OC |
| InChI | InChI=1S/C26H38O6Si/c1-11-12-13-14-20(32-33(9,10)26(5,6)7)16-21(27)17(2)15-18(3)23(28)22-24(30-8)19(4)31-25(22)29/h11-14,16-18H,4,15H2,1-3,5-10H3/b12-11+,14-13+,20-16+/t17-,18+/m0/s1 |
| InChIKey | WFPFNGZRPCVBKO-OPPFYHCMSA-N |
| XLogP | 5.80 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|