C15H17ClO3 — CID 101377289
ethyl (2E,4E)-2-[(4-chlorophenyl)-hydroxymethyl]hexa-2,4-dienoate (PubChem CID 101377289) has the molecular formula C15H17ClO3 and a molecular weight of 280.75 g/mol. Its IUPAC name is ethyl (2E,4E)-2-[(4-chlorophenyl)-hydroxymethyl]hexa-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-2-[(4-chlorophenyl)-hydroxymethyl]hexa-2,4-dienoate |
|---|---|
| PubChem CID | 101377289 |
| Molecular Formula | C15H17ClO3 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | ethyl (2E,4E)-2-[(4-chlorophenyl)-hydroxymethyl]hexa-2,4-dienoate |
| SMILES | C/C=C/C=C(/C(=O)OCC)C(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H17ClO3/c1-3-5-6-13(15(18)19-4-2)14(17)11-7-9-12(16)10-8-11/h3,5-10,14,17H,4H2,1-2H3/b5-3+,13-6+ |
| InChIKey | WMJUIVPUVMPMED-ZQDGOMPYSA-N |
| XLogP | 3.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|