C15H18N2O2 — CID 101377555
(3S)-3-benzyl-1,3,4,5a,6,7,8,8a-octahydrocyclopenta[e][1,4]diazepine-2,5-dione (PubChem CID 101377555) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is (3S)-3-benzyl-1,3,4,5a,6,7,8,8a-octahydrocyclopenta[e][1,4]diazepine-2,5-dione.
| Compound Name | (3S)-3-benzyl-1,3,4,5a,6,7,8,8a-octahydrocyclopenta[e][1,4]diazepine-2,5-dione |
|---|---|
| PubChem CID | 101377555 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (3S)-3-benzyl-1,3,4,5a,6,7,8,8a-octahydrocyclopenta[e][1,4]diazepine-2,5-dione |
| SMILES | O=C1N[C@@H](Cc2ccccc2)C(=O)NC2CCCC12 |
| InChI | InChI=1S/C15H18N2O2/c18-14-11-7-4-8-12(11)16-15(19)13(17-14)9-10-5-2-1-3-6-10/h1-3,5-6,11-13H,4,7-9H2,(H,16,19)(H,17,18)/t11?,12?,13-/m0/s1 |
| InChIKey | LHBYADRLPOPCJP-BPCQOVAHSA-N |
| XLogP | 1.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |