C18H24O2 — CID 101377743
1-[(2S,3R,6S)-2-(2-phenylethyl)-6-prop-2-enyloxan-3-yl]ethanone (PubChem CID 101377743) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-[(2S,3R,6S)-2-(2-phenylethyl)-6-prop-2-enyloxan-3-yl]ethanone.
| Compound Name | 1-[(2S,3R,6S)-2-(2-phenylethyl)-6-prop-2-enyloxan-3-yl]ethanone |
|---|---|
| PubChem CID | 101377743 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 1-[(2S,3R,6S)-2-(2-phenylethyl)-6-prop-2-enyloxan-3-yl]ethanone |
| SMILES | C=CC[C@@H]1CC[C@@H](C(C)=O)[C@H](CCc2ccccc2)O1 |
| InChI | InChI=1S/C18H24O2/c1-3-7-16-11-12-17(14(2)19)18(20-16)13-10-15-8-5-4-6-9-15/h3-6,8-9,16-18H,1,7,10-13H2,2H3/t16-,17+,18+/m1/s1 |
| InChIKey | YIQADIYZFPNEOG-SQNIBIBYSA-N |
| XLogP | 3.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|