C20H18INO4 — CID 101377966
methyl (1S,8S,9R,12R)-8-iodo-12-(4-methylphenyl)-11-oxo-10-oxa-13-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxylate (PubChem CID 101377966) has the molecular formula C20H18INO4 and a molecular weight of 463.27 g/mol. Its IUPAC name is methyl (1S,8S,9R,12R)-8-iodo-12-(4-methylphenyl)-11-oxo-10-oxa-13-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxylate.
| Compound Name | methyl (1S,8S,9R,12R)-8-iodo-12-(4-methylphenyl)-11-oxo-10-oxa-13-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxylate |
|---|---|
| PubChem CID | 101377966 |
| Molecular Formula | C20H18INO4 |
| Molecular Weight | 463.27 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | methyl (1S,8S,9R,12R)-8-iodo-12-(4-methylphenyl)-11-oxo-10-oxa-13-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxylate |
| SMILES | COC(=O)N1[C@@H]2OC(=O)[C@H](c3ccc(C)cc3)[C@H]1c1ccccc1[C@@H]2I |
| InChI | InChI=1S/C20H18INO4/c1-11-7-9-12(10-8-11)15-17-14-6-4-3-5-13(14)16(21)18(26-19(15)23)22(17)20(24)25-2/h3-10,15-18H,1-2H3/t15-,16+,17-,18-/m1/s1 |
| InChIKey | NPMFVODYTDELHG-XMTFNYHQSA-N |
| XLogP | 4.26 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.27 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|