C8H12F3NO2 — CID 101378034
2,2,2-trifluoro-N-[(1S,2R)-2-hydroxycyclohexyl]acetamide (PubChem CID 101378034) has the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1S,2R)-2-hydroxycyclohexyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(1S,2R)-2-hydroxycyclohexyl]acetamide |
|---|---|
| PubChem CID | 101378034 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1S,2R)-2-hydroxycyclohexyl]acetamide |
| SMILES | O=C(N[C@H]1CCCC[C@H]1O)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO2/c9-8(10,11)7(14)12-5-3-1-2-4-6(5)13/h5-6,13H,1-4H2,(H,12,14)/t5-,6+/m0/s1 |
| InChIKey | UEAIDZOHHRNGHS-NTSWFWBYSA-N |
| XLogP | 0.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |