C21H30O3 — CID 101378165
(2R,8R,9S,10R,13S,14S)-2-ethoxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 101378165) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (2R,8R,9S,10R,13S,14S)-2-ethoxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (2R,8R,9S,10R,13S,14S)-2-ethoxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 101378165 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (2R,8R,9S,10R,13S,14S)-2-ethoxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | CCO[C@@H]1C[C@@]2(C)C(=CC1=O)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C21H30O3/c1-4-24-18-12-21(3)13(11-17(18)22)5-6-14-15-7-8-19(23)20(15,2)10-9-16(14)21/h11,14-16,18H,4-10,12H2,1-3H3/t14-,15-,16-,18+,20-,21-/m0/s1 |
| InChIKey | WRSBMOMWAZJICA-XDBTUQKASA-N |
| XLogP | 4.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |