C7H8O5 — CID 101378285
(2R,3aS,6aR)-5-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-carboxylic acid (PubChem CID 101378285) has the molecular formula C7H8O5 and a molecular weight of 172.14 g/mol. Its IUPAC name is (2R,3aS,6aR)-5-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-carboxylic acid.
| Compound Name | (2R,3aS,6aR)-5-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 101378285 |
| Molecular Formula | C7H8O5 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | (2R,3aS,6aR)-5-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-carboxylic acid |
| SMILES | O=C1C[C@@H]2C[C@H](C(=O)O)O[C@@H]2O1 |
| InChI | InChI=1S/C7H8O5/c8-5-2-3-1-4(6(9)10)11-7(3)12-5/h3-4,7H,1-2H2,(H,9,10)/t3-,4+,7+/m0/s1 |
| InChIKey | UFXYBTONYQOFKY-PJVAAEDRSA-N |
| XLogP | -0.25 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |