C21H14N4O2S — CID 101379583
2-[1-(3,5-dimethoxyphenyl)-5-thiophen-2-ylpyrrol-2-yl]ethene-1,1,2-tricarbonitrile (PubChem CID 101379583) has the molecular formula C21H14N4O2S and a molecular weight of 386.44 g/mol. Its IUPAC name is 2-[1-(3,5-dimethoxyphenyl)-5-thiophen-2-ylpyrrol-2-yl]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[1-(3,5-dimethoxyphenyl)-5-thiophen-2-ylpyrrol-2-yl]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 101379583 |
| Molecular Formula | C21H14N4O2S |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2-[1-(3,5-dimethoxyphenyl)-5-thiophen-2-ylpyrrol-2-yl]ethene-1,1,2-tricarbonitrile |
| SMILES | COc1cc(OC)cc(-n2c(C(C#N)=C(C#N)C#N)ccc2-c2cccs2)c1 |
| InChI | InChI=1S/C21H14N4O2S/c1-26-16-8-15(9-17(10-16)27-2)25-19(18(13-24)14(11-22)12-23)5-6-20(25)21-4-3-7-28-21/h3-10H,1-2H3 |
| InChIKey | GTLJUSFFDSQWKE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 94.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|