C13H12N2O3S — CID 101379589
ethyl 6-[(1E)-buta-1,3-dienyl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylate (PubChem CID 101379589) has the molecular formula C13H12N2O3S and a molecular weight of 276.32 g/mol. Its IUPAC name is ethyl 6-[(1E)-buta-1,3-dienyl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylate.
| Compound Name | ethyl 6-[(1E)-buta-1,3-dienyl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 101379589 |
| Molecular Formula | C13H12N2O3S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | ethyl 6-[(1E)-buta-1,3-dienyl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylate |
| SMILES | C=C/C=C/c1cnc2sc(C(=O)OCC)cn2c1=O |
| InChI | InChI=1S/C13H12N2O3S/c1-3-5-6-9-7-14-13-15(11(9)16)8-10(19-13)12(17)18-4-2/h3,5-8H,1,4H2,2H3/b6-5+ |
| InChIKey | YASZWSIPIRAVNG-AATRIKPKSA-N |
| XLogP | 2.13 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|