C21H16ClF2N3O2 — CID 101379682
7-chloro-2-[(1R)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]-5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-one (PubChem CID 101379682) has the molecular formula C21H16ClF2N3O2 and a molecular weight of 415.83 g/mol. Its IUPAC name is 7-chloro-2-[(1R)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]-5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-one.
| Compound Name | 7-chloro-2-[(1R)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]-5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-one |
|---|---|
| PubChem CID | 101379682 |
| Molecular Formula | C21H16ClF2N3O2 |
| Molecular Weight | 415.83 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 7-chloro-2-[(1R)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]-5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-one |
| SMILES | Cc1cc2nn([C@H](C)[C@@]3(c4ccc(F)cc4F)CO3)c(=O)n2c2ccc(Cl)cc12 |
| InChI | InChI=1S/C21H16ClF2N3O2/c1-11-7-19-25-27(20(28)26(19)18-6-3-13(22)8-15(11)18)12(2)21(10-29-21)16-5-4-14(23)9-17(16)24/h3-9,12H,10H2,1-2H3/t12-,21-/m1/s1 |
| InChIKey | OYJBKLPLNWXZAX-XUSGNXJCSA-N |
| XLogP | 4.38 |
| TPSA | 51.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.83 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|