C12H20O2 — CID 101379815
(1S,3S,4R,5R,7R)-3,7-dimethyladamantane-1,4-diol (PubChem CID 101379815) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (1S,3S,4R,5R,7R)-3,7-dimethyladamantane-1,4-diol.
| Compound Name | (1S,3S,4R,5R,7R)-3,7-dimethyladamantane-1,4-diol |
|---|---|
| PubChem CID | 101379815 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (1S,3S,4R,5R,7R)-3,7-dimethyladamantane-1,4-diol |
| SMILES | C[C@]12C[C@@H]3C[C@](O)(C1)C[C@](C)(C2)[C@@H]3O |
| InChI | InChI=1S/C12H20O2/c1-10-3-8-4-12(14,6-10)7-11(2,5-10)9(8)13/h8-9,13-14H,3-7H2,1-2H3/t8-,9-,10-,11+,12+/m1/s1 |
| InChIKey | QCJOVNGHGQOVMI-JCIQBVFBSA-N |
| XLogP | 1.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |