About 1-[(1Z)-2-methylbuta-1,3-dienyl]indole
1-[(1Z)-2-methylbuta-1,3-dienyl]indole (PubChem CID 101380720) has the molecular formula C13H13N
and a molecular weight of 183.25 g/mol. Its IUPAC name is 1-[(1Z)-2-methylbuta-1,3-dienyl]indole.
Molecular Properties
| Compound Name | 1-[(1Z)-2-methylbuta-1,3-dienyl]indole |
| PubChem CID | 101380720 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 1-[(1Z)-2-methylbuta-1,3-dienyl]indole |
| SMILES | C=C/C(C)=C\n1ccc2ccccc21 |
| InChI | InChI=1S/C13H13N/c1-3-11(2)10-14-9-8-12-6-4-5-7-13(12)14/h3-10H,1H2,2H3/b11-10- |
| InChIKey | CKQVFOSKHCWQMX-KHPPLWFESA-N |
| XLogP | 3.69 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1Z)-2-methylbuta-1,3-dienyl]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1Z)-2-methylbuta-1,3-dienyl]indole?
The IUPAC name of 1-[(1Z)-2-methylbuta-1,3-dienyl]indole (CID 101380720) is 1-[(1Z)-2-methylbuta-1,3-dienyl]indole.
What is the SMILES notation for 1-[(1Z)-2-methylbuta-1,3-dienyl]indole?
The canonical SMILES for 1-[(1Z)-2-methylbuta-1,3-dienyl]indole is C=C/C(C)=C\n1ccc2ccccc21.
What is the InChIKey of 1-[(1Z)-2-methylbuta-1,3-dienyl]indole?
The InChIKey is CKQVFOSKHCWQMX-KHPPLWFESA-N. The full InChI is InChI=1S/C13H13N/c1-3-11(2)10-14-9-8-12-6-4-5-7-13(12)14/h3-10H,1H2,2H3/b11-10-.
What are the key properties of 1-[(1Z)-2-methylbuta-1,3-dienyl]indole?
1-[(1Z)-2-methylbuta-1,3-dienyl]indole has a molecular weight of 183.25 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1Z)-2-methylbuta-1,3-dienyl]indole is sourced from PubChem (CID 101380720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).