About CID 101380846
CID 101380846 (PubChem CID 101380846) has the molecular formula C20H23S3
and a molecular weight of 359.60 g/mol.
Molecular Properties
| Compound Name | CID 101380846 |
| PubChem CID | 101380846 |
| Molecular Formula | C20H23S3 |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | — |
| SMILES | CCCCc1c(CCCC)c(=C2C=CC#S2)sc1=C1C=C[CH]S1 |
| InChI | InChI=1S/C20H23S3/c1-3-5-9-15-16(10-6-4-2)20(18-12-8-14-22-18)23-19(15)17-11-7-13-21-17/h7-8,11-13H,3-6,9-10H2,1-2H3 |
| InChIKey | KDVAUIBXZPMCGN-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 101380846 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101380846?
The IUPAC name of CID 101380846 (CID 101380846) is not available.
What is the SMILES notation for CID 101380846?
The canonical SMILES for CID 101380846 is CCCCc1c(CCCC)c(=C2C=CC#S2)sc1=C1C=C[CH]S1.
What is the InChIKey of CID 101380846?
The InChIKey is KDVAUIBXZPMCGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23S3/c1-3-5-9-15-16(10-6-4-2)20(18-12-8-14-22-18)23-19(15)17-11-7-13-21-17/h7-8,11-13H,3-6,9-10H2,1-2H3.
What are the key properties of CID 101380846?
CID 101380846 has a molecular weight of 359.60 g/mol, XLogP of 5.38, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101380846 is sourced from PubChem (CID 101380846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).