About 2-(1,3-benzodioxol-5-ylmethylamino)-N-(4-phenoxyphenyl)pyridine-3-carboxamide
2-(1,3-benzodioxol-5-ylmethylamino)-N-(4-phenoxyphenyl)pyridine-3-carboxamide (PubChem CID 10138086) has the molecular formula C26H21N3O4
and a molecular weight of 439.47 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethylamino)-N-(4-phenoxyphenyl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-(1,3-benzodioxol-5-ylmethylamino)-N-(4-phenoxyphenyl)pyridine-3-carboxamide |
| PubChem CID | 10138086 |
| Molecular Formula | C26H21N3O4 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethylamino)-N-(4-phenoxyphenyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)c1cccnc1NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H21N3O4/c30-26(29-19-9-11-21(12-10-19)33-20-5-2-1-3-6-20)22-7-4-14-27-25(22)28-16-18-8-13-23-24(15-18)32-17-31-23/h1-15H,16-17H2,(H,27,28)(H,29,30) |
| InChIKey | KFVKYZSMMMDKRE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(1,3-benzodioxol-5-ylmethylamino)-N-(4-phenoxyphenyl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzodioxol-5-ylmethylamino)-N-(4-phenoxyphenyl)pyridine-3-carboxamide?
The IUPAC name of 2-(1,3-benzodioxol-5-ylmethylamino)-N-(4-phenoxyphenyl)pyridine-3-carboxamide (CID 10138086) is 2-(1,3-benzodioxol-5-ylmethylamino)-N-(4-phenoxyphenyl)pyridine-3-carboxamide.
What is the SMILES notation for 2-(1,3-benzodioxol-5-ylmethylamino)-N-(4-phenoxyphenyl)pyridine-3-carboxamide?
The canonical SMILES for 2-(1,3-benzodioxol-5-ylmethylamino)-N-(4-phenoxyphenyl)pyridine-3-carboxamide is O=C(Nc1ccc(Oc2ccccc2)cc1)c1cccnc1NCc1ccc2c(c1)OCO2.
What is the InChIKey of 2-(1,3-benzodioxol-5-ylmethylamino)-N-(4-phenoxyphenyl)pyridine-3-carboxamide?
The InChIKey is KFVKYZSMMMDKRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21N3O4/c30-26(29-19-9-11-21(12-10-19)33-20-5-2-1-3-6-20)22-7-4-14-27-25(22)28-16-18-8-13-23-24(15-18)32-17-31-23/h1-15H,16-17H2,(H,27,28)(H,29,30).
What are the key properties of 2-(1,3-benzodioxol-5-ylmethylamino)-N-(4-phenoxyphenyl)pyridine-3-carboxamide?
2-(1,3-benzodioxol-5-ylmethylamino)-N-(4-phenoxyphenyl)pyridine-3-carboxamide has a molecular weight of 439.47 g/mol, XLogP of 5.47, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-5-ylmethylamino)-N-(4-phenoxyphenyl)pyridine-3-carboxamide is sourced from PubChem (CID 10138086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).