C13H2Cl2F6S2 — CID 101381002
4,14-dichloro-8,8,9,9,10,10-hexafluoro-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,11,13-pentaene (PubChem CID 101381002) has the molecular formula C13H2Cl2F6S2 and a molecular weight of 407.19 g/mol. Its IUPAC name is 4,14-dichloro-8,8,9,9,10,10-hexafluoro-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,11,13-pentaene.
| Compound Name | 4,14-dichloro-8,8,9,9,10,10-hexafluoro-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,11,13-pentaene |
|---|---|
| PubChem CID | 101381002 |
| Molecular Formula | C13H2Cl2F6S2 |
| Molecular Weight | 407.19 g/mol |
| Exact Mass | 405.89 |
| IUPAC Name | 4,14-dichloro-8,8,9,9,10,10-hexafluoro-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,11,13-pentaene |
| SMILES | FC1(F)c2c(c3cc(Cl)sc3c3sc(Cl)cc23)C(F)(F)C1(F)F |
| InChI | InChI=1S/C13H2Cl2F6S2/c14-5-1-3-7-8(12(18,19)13(20,21)11(7,16)17)4-2-6(15)23-10(4)9(3)22-5/h1-2H |
| InChIKey | GHBSNKIPIWBCCT-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.19 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|