C15H4F6O2S2 — CID 101381004
8,8,9,9,10,10-hexafluoro-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,11,13-pentaene-4,14-dicarbaldehyde (PubChem CID 101381004) has the molecular formula C15H4F6O2S2 and a molecular weight of 394.32 g/mol. Its IUPAC name is 8,8,9,9,10,10-hexafluoro-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,11,13-pentaene-4,14-dicarbaldehyde.
| Compound Name | 8,8,9,9,10,10-hexafluoro-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,11,13-pentaene-4,14-dicarbaldehyde |
|---|---|
| PubChem CID | 101381004 |
| Molecular Formula | C15H4F6O2S2 |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | 8,8,9,9,10,10-hexafluoro-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,11,13-pentaene-4,14-dicarbaldehyde |
| SMILES | O=Cc1cc2c3c(c4cc(C=O)sc4c2s1)C(F)(F)C(F)(F)C3(F)F |
| InChI | InChI=1S/C15H4F6O2S2/c16-13(17)9-7-1-5(3-22)24-11(7)12-8(2-6(4-23)25-12)10(9)14(18,19)15(13,20)21/h1-4H |
| InChIKey | DFUVLSJVRXQVRJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|