C23H35N3O4 — CID 101381411
tert-butyl (3R,6R,9aR)-3-ethyl-6-[(3-methoxyphenyl)methyl]-8-methyl-7-oxo-1,3,4,6,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxylate (PubChem CID 101381411) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is tert-butyl (3R,6R,9aR)-3-ethyl-6-[(3-methoxyphenyl)methyl]-8-methyl-7-oxo-1,3,4,6,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxylate.
| Compound Name | tert-butyl (3R,6R,9aR)-3-ethyl-6-[(3-methoxyphenyl)methyl]-8-methyl-7-oxo-1,3,4,6,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 101381411 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | tert-butyl (3R,6R,9aR)-3-ethyl-6-[(3-methoxyphenyl)methyl]-8-methyl-7-oxo-1,3,4,6,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxylate |
| SMILES | CC[C@@H]1CN2[C@H](CN(C)C(=O)[C@H]2Cc2cccc(OC)c2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H35N3O4/c1-7-17-14-25-18(15-26(17)22(28)30-23(2,3)4)13-24(5)21(27)20(25)12-16-9-8-10-19(11-16)29-6/h8-11,17-18,20H,7,12-15H2,1-6H3/t17-,18-,20-/m1/s1 |
| InChIKey | KRELTGVBVIZJEL-QWFCFKBJSA-N |
| XLogP | 2.78 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |