C22H18FNO3S — CID 101382323
[(2S,3R)-3-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]-phenylmethanone (PubChem CID 101382323) has the molecular formula C22H18FNO3S and a molecular weight of 395.46 g/mol. Its IUPAC name is [(2S,3R)-3-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]-phenylmethanone.
| Compound Name | [(2S,3R)-3-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 101382323 |
| Molecular Formula | C22H18FNO3S |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | [(2S,3R)-3-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]-phenylmethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H](C(=O)c3ccccc3)[C@H]2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H18FNO3S/c1-15-7-13-19(14-8-15)28(26,27)24-20(16-9-11-18(23)12-10-16)21(24)22(25)17-5-3-2-4-6-17/h2-14,20-21H,1H3/t20-,21+,24?/m1/s1 |
| InChIKey | IWQDRDDYESOHJK-JBAPTLGWSA-N |
| XLogP | 4.13 |
| TPSA | 54.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|