C12H13Cl3O8 — CID 101382353
[(2'S,3S,3'aS,6'R,6'aR)-6-hydroxy-6-methyl-2'-(trichloromethyl)spiro[1,2-dioxine-3,5'-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-6'-yl] acetate (PubChem CID 101382353) has the molecular formula C12H13Cl3O8 and a molecular weight of 391.59 g/mol. Its IUPAC name is [(2'S,3S,3'aS,6'R,6'aR)-6-hydroxy-6-methyl-2'-(trichloromethyl)spiro[1,2-dioxine-3,5'-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-6'-yl] acetate.
| Compound Name | [(2'S,3S,3'aS,6'R,6'aR)-6-hydroxy-6-methyl-2'-(trichloromethyl)spiro[1,2-dioxine-3,5'-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-6'-yl] acetate |
|---|---|
| PubChem CID | 101382353 |
| Molecular Formula | C12H13Cl3O8 |
| Molecular Weight | 391.59 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | [(2'S,3S,3'aS,6'R,6'aR)-6-hydroxy-6-methyl-2'-(trichloromethyl)spiro[1,2-dioxine-3,5'-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-6'-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2O[C@H](C(Cl)(Cl)Cl)O[C@H]2O[C@]12C=CC(C)(O)OO2 |
| InChI | InChI=1S/C12H13Cl3O8/c1-5(16)18-7-6-8(20-9(19-6)12(13,14)15)21-11(7)4-3-10(2,17)22-23-11/h3-4,6-9,17H,1-2H3/t6-,7-,8+,9+,10?,11+/m1/s1 |
| InChIKey | KRAYPIPEHKDQEV-KFPDDTRNSA-N |
| XLogP | 1.31 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.59 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|