C16H34O6Si — CID 101382588
(4R,5S)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]-2,2-dimethyl-1,3-dioxan-5-ol (PubChem CID 101382588) has the molecular formula C16H34O6Si and a molecular weight of 350.53 g/mol. Its IUPAC name is (4R,5S)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]-2,2-dimethyl-1,3-dioxan-5-ol.
| Compound Name | (4R,5S)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]-2,2-dimethyl-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 101382588 |
| Molecular Formula | C16H34O6Si |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (4R,5S)-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]-2,2-dimethyl-1,3-dioxan-5-ol |
| SMILES | COC(OC)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)OC[C@@H]1O |
| InChI | InChI=1S/C16H34O6Si/c1-15(2,3)23(8,9)22-13(14(18-6)19-7)12-11(17)10-20-16(4,5)21-12/h11-14,17H,10H2,1-9H3/t11-,12+,13+/m0/s1 |
| InChIKey | BROJUQGFXUGFJK-YNEHKIRRSA-N |
| XLogP | 2.51 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|