C18H14O2S7 — CID 101382609
5,7-bis(2,3-dihydrothieno[3,4-b][1,4]dithiin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 101382609) has the molecular formula C18H14O2S7 and a molecular weight of 486.78 g/mol. Its IUPAC name is 5,7-bis(2,3-dihydrothieno[3,4-b][1,4]dithiin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5,7-bis(2,3-dihydrothieno[3,4-b][1,4]dithiin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 101382609 |
| Molecular Formula | C18H14O2S7 |
| Molecular Weight | 486.78 g/mol |
| Exact Mass | 485.90 |
| IUPAC Name | 5,7-bis(2,3-dihydrothieno[3,4-b][1,4]dithiin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | c1sc(-c2sc(-c3scc4c3SCCS4)c3c2OCCO3)c2c1SCCS2 |
| InChI | InChI=1S/C18H14O2S7/c1-2-20-12-11(19-1)15(17-13-9(7-25-17)21-3-5-23-13)27-16(12)18-14-10(8-26-18)22-4-6-24-14/h7-8H,1-6H2 |
| InChIKey | PKNQXFIRGHELLS-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.78 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |