About (4S)-4-tert-butyl-2-(1-chloro-3-iodo-2-methylpropan-2-yl)-4,5-dihydro-1,3-oxazole
(4S)-4-tert-butyl-2-(1-chloro-3-iodo-2-methylpropan-2-yl)-4,5-dihydro-1,3-oxazole (PubChem CID 101382779) has the molecular formula C11H19ClINO
and a molecular weight of 343.64 g/mol. Its IUPAC name is (4S)-4-tert-butyl-2-(1-chloro-3-iodo-2-methylpropan-2-yl)-4,5-dihydro-1,3-oxazole.
Molecular Properties
| Compound Name | (4S)-4-tert-butyl-2-(1-chloro-3-iodo-2-methylpropan-2-yl)-4,5-dihydro-1,3-oxazole |
| PubChem CID | 101382779 |
| Molecular Formula | C11H19ClINO |
| Molecular Weight | 343.64 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | (4S)-4-tert-butyl-2-(1-chloro-3-iodo-2-methylpropan-2-yl)-4,5-dihydro-1,3-oxazole |
| SMILES | CC(CCl)(CI)C1=N[C@@H](C(C)(C)C)CO1 |
| InChI | InChI=1S/C11H19ClINO/c1-10(2,3)8-5-15-9(14-8)11(4,6-12)7-13/h8H,5-7H2,1-4H3/t8-,11?/m1/s1 |
| InChIKey | IHJYPAYZQUYYRL-RZZZFEHKSA-N |
| XLogP | 3.51 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.64 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-tert-butyl-2-(1-chloro-3-iodo-2-methylpropan-2-yl)-4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-tert-butyl-2-(1-chloro-3-iodo-2-methylpropan-2-yl)-4,5-dihydro-1,3-oxazole?
The IUPAC name of (4S)-4-tert-butyl-2-(1-chloro-3-iodo-2-methylpropan-2-yl)-4,5-dihydro-1,3-oxazole (CID 101382779) is (4S)-4-tert-butyl-2-(1-chloro-3-iodo-2-methylpropan-2-yl)-4,5-dihydro-1,3-oxazole.
What is the SMILES notation for (4S)-4-tert-butyl-2-(1-chloro-3-iodo-2-methylpropan-2-yl)-4,5-dihydro-1,3-oxazole?
The canonical SMILES for (4S)-4-tert-butyl-2-(1-chloro-3-iodo-2-methylpropan-2-yl)-4,5-dihydro-1,3-oxazole is CC(CCl)(CI)C1=N[C@@H](C(C)(C)C)CO1.
What is the InChIKey of (4S)-4-tert-butyl-2-(1-chloro-3-iodo-2-methylpropan-2-yl)-4,5-dihydro-1,3-oxazole?
The InChIKey is IHJYPAYZQUYYRL-RZZZFEHKSA-N. The full InChI is InChI=1S/C11H19ClINO/c1-10(2,3)8-5-15-9(14-8)11(4,6-12)7-13/h8H,5-7H2,1-4H3/t8-,11?/m1/s1.
What are the key properties of (4S)-4-tert-butyl-2-(1-chloro-3-iodo-2-methylpropan-2-yl)-4,5-dihydro-1,3-oxazole?
(4S)-4-tert-butyl-2-(1-chloro-3-iodo-2-methylpropan-2-yl)-4,5-dihydro-1,3-oxazole has a molecular weight of 343.64 g/mol, XLogP of 3.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-tert-butyl-2-(1-chloro-3-iodo-2-methylpropan-2-yl)-4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 101382779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).