C12H16O5 — CID 101383035
(3S,7R,8R)-7,8-dihydroxy-3-propyl-4,6,7,8-tetrahydro-3H-isochromene-1,5-dione (PubChem CID 101383035) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is (3S,7R,8R)-7,8-dihydroxy-3-propyl-4,6,7,8-tetrahydro-3H-isochromene-1,5-dione.
| Compound Name | (3S,7R,8R)-7,8-dihydroxy-3-propyl-4,6,7,8-tetrahydro-3H-isochromene-1,5-dione |
|---|---|
| PubChem CID | 101383035 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (3S,7R,8R)-7,8-dihydroxy-3-propyl-4,6,7,8-tetrahydro-3H-isochromene-1,5-dione |
| SMILES | CCC[C@H]1CC2=C(C(=O)O1)[C@@H](O)[C@H](O)CC2=O |
| InChI | InChI=1S/C12H16O5/c1-2-3-6-4-7-8(13)5-9(14)11(15)10(7)12(16)17-6/h6,9,11,14-15H,2-5H2,1H3/t6-,9+,11-/m0/s1 |
| InChIKey | UJTPZWKMPAKALM-OIVXANJASA-N |
| XLogP | 0.09 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |