C27H25NO5 — CID 10138321
2-[5-methoxy-2-methyl-1-[4-(2-phenylethoxy)benzoyl]indol-3-yl]acetic acid (PubChem CID 10138321) has the molecular formula C27H25NO5 and a molecular weight of 443.50 g/mol. Its IUPAC name is 2-[5-methoxy-2-methyl-1-[4-(2-phenylethoxy)benzoyl]indol-3-yl]acetic acid.
| Compound Name | 2-[5-methoxy-2-methyl-1-[4-(2-phenylethoxy)benzoyl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 10138321 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 2-[5-methoxy-2-methyl-1-[4-(2-phenylethoxy)benzoyl]indol-3-yl]acetic acid |
| SMILES | COc1ccc2c(c1)c(CC(=O)O)c(C)n2C(=O)c1ccc(OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H25NO5/c1-18-23(17-26(29)30)24-16-22(32-2)12-13-25(24)28(18)27(31)20-8-10-21(11-9-20)33-15-14-19-6-4-3-5-7-19/h3-13,16H,14-15,17H2,1-2H3,(H,29,30) |
| InChIKey | PNKJPWWONZMTTI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |