C23H39NO3S — CID 101383348
N-(1-hydroxy-3-methylideneheptan-2-yl)-2,4,6-tri(propan-2-yl)benzenesulfonamide (PubChem CID 101383348) has the molecular formula C23H39NO3S and a molecular weight of 409.64 g/mol. Its IUPAC name is N-(1-hydroxy-3-methylideneheptan-2-yl)-2,4,6-tri(propan-2-yl)benzenesulfonamide.
| Compound Name | N-(1-hydroxy-3-methylideneheptan-2-yl)-2,4,6-tri(propan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 101383348 |
| Molecular Formula | C23H39NO3S |
| Molecular Weight | 409.64 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | N-(1-hydroxy-3-methylideneheptan-2-yl)-2,4,6-tri(propan-2-yl)benzenesulfonamide |
| SMILES | C=C(CCCC)C(CO)NS(=O)(=O)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C23H39NO3S/c1-9-10-11-18(8)22(14-25)24-28(26,27)23-20(16(4)5)12-19(15(2)3)13-21(23)17(6)7/h12-13,15-17,22,24-25H,8-11,14H2,1-7H3 |
| InChIKey | NWIOYCSXKKFJOI-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.64 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|