C38H64N2O4S2Si — CID 101383350
2,4,6-tri(propan-2-yl)-N-[3-(trimethylsilylmethyl)-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]but-3-enyl]benzenesulfonamide (PubChem CID 101383350) has the molecular formula C38H64N2O4S2Si and a molecular weight of 705.16 g/mol. Its IUPAC name is 2,4,6-tri(propan-2-yl)-N-[3-(trimethylsilylmethyl)-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]but-3-enyl]benzenesulfonamide.
| Compound Name | 2,4,6-tri(propan-2-yl)-N-[3-(trimethylsilylmethyl)-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]but-3-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 101383350 |
| Molecular Formula | C38H64N2O4S2Si |
| Molecular Weight | 705.16 g/mol |
| Exact Mass | 704.41 |
| IUPAC Name | 2,4,6-tri(propan-2-yl)-N-[3-(trimethylsilylmethyl)-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]but-3-enyl]benzenesulfonamide |
| SMILES | C=C(C[Si](C)(C)C)C(CNS(=O)(=O)c1c(C(C)C)cc(C(C)C)cc1C(C)C)NS(=O)(=O)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C38H64N2O4S2Si/c1-23(2)30-17-32(25(5)6)37(33(18-30)26(7)8)45(41,42)39-21-36(29(13)22-47(14,15)16)40-46(43,44)38-34(27(9)10)19-31(24(3)4)20-35(38)28(11)12/h17-20,23-28,36,39-40H,13,21-22H2,1-12,14-16H3 |
| InChIKey | OJLVLJCESHOTOM-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.16 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|