C33H24F6NO2S2+ — CID 101383679
4-[4-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-(1-methylpyridin-1-ium-4-yl)thiophen-3-yl]cyclopenten-1-yl]-5-(4-methoxyphenyl)thiophen-2-yl]phenol (PubChem CID 101383679) has the molecular formula C33H24F6NO2S2+ and a molecular weight of 644.68 g/mol. Its IUPAC name is 4-[4-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-(1-methylpyridin-1-ium-4-yl)thiophen-3-yl]cyclopenten-1-yl]-5-(4-methoxyphenyl)thiophen-2-yl]phenol.
| Compound Name | 4-[4-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-(1-methylpyridin-1-ium-4-yl)thiophen-3-yl]cyclopenten-1-yl]-5-(4-methoxyphenyl)thiophen-2-yl]phenol |
|---|---|
| PubChem CID | 101383679 |
| Molecular Formula | C33H24F6NO2S2+ |
| Molecular Weight | 644.68 g/mol |
| Exact Mass | 644.11 |
| IUPAC Name | 4-[4-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-(1-methylpyridin-1-ium-4-yl)thiophen-3-yl]cyclopenten-1-yl]-5-(4-methoxyphenyl)thiophen-2-yl]phenol |
| SMILES | COc1ccc(-c2sc(-c3ccc(O)cc3)cc2C2=C(c3cc(-c4cc[n+](C)cc4)sc3C)C(F)(F)C(F)(F)C2(F)F)cc1 |
| InChI | InChI=1S/C33H23F6NO2S2/c1-18-24(16-26(43-18)20-12-14-40(2)15-13-20)28-29(32(36,37)33(38,39)31(28,34)35)25-17-27(19-4-8-22(41)9-5-19)44-30(25)21-6-10-23(42-3)11-7-21/h4-17H,1-3H3/p+1 |
| InChIKey | MMZGIWFEOCIQPL-UHFFFAOYSA-O |
| XLogP | 9.49 |
| TPSA | 33.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.68 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|