C13H13BrF2NO3PS2 — CID 10138369
[[2-bromo-4-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanylmethyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 10138369) has the molecular formula C13H13BrF2NO3PS2 and a molecular weight of 444.26 g/mol. Its IUPAC name is [[2-bromo-4-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanylmethyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-bromo-4-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanylmethyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 10138369 |
| Molecular Formula | C13H13BrF2NO3PS2 |
| Molecular Weight | 444.26 g/mol |
| Exact Mass | 442.92 |
| IUPAC Name | [[2-bromo-4-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanylmethyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | Cc1nc(SCc2ccc(C(F)(F)P(=O)(O)O)c(Br)c2)sc1C |
| InChI | InChI=1S/C13H13BrF2NO3PS2/c1-7-8(2)23-12(17-7)22-6-9-3-4-10(11(14)5-9)13(15,16)21(18,19)20/h3-5H,6H2,1-2H3,(H2,18,19,20) |
| InChIKey | ZGGHOGACBCIFFV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.26 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|