C20H15Cl2N5OS — CID 10138373
1-(3,5-dichlorophenyl)-3-[3-(3H-imidazo[4,5-c]pyridin-2-yl)-4-methoxyphenyl]thiourea (PubChem CID 10138373) has the molecular formula C20H15Cl2N5OS and a molecular weight of 444.35 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[3-(3H-imidazo[4,5-c]pyridin-2-yl)-4-methoxyphenyl]thiourea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[3-(3H-imidazo[4,5-c]pyridin-2-yl)-4-methoxyphenyl]thiourea |
|---|---|
| PubChem CID | 10138373 |
| Molecular Formula | C20H15Cl2N5OS |
| Molecular Weight | 444.35 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[3-(3H-imidazo[4,5-c]pyridin-2-yl)-4-methoxyphenyl]thiourea |
| SMILES | COc1ccc(NC(=S)Nc2cc(Cl)cc(Cl)c2)cc1-c1nc2ccncc2[nH]1 |
| InChI | InChI=1S/C20H15Cl2N5OS/c1-28-18-3-2-13(24-20(29)25-14-7-11(21)6-12(22)8-14)9-15(18)19-26-16-4-5-23-10-17(16)27-19/h2-10H,1H3,(H,26,27)(H2,24,25,29) |
| InChIKey | UERDXFBFFINSMM-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.35 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|