About CID 101383861
CID 101383861 (PubChem CID 101383861) has the molecular formula C23H22OS
and a molecular weight of 346.49 g/mol.
Molecular Properties
| Compound Name | CID 101383861 |
| PubChem CID | 101383861 |
| Molecular Formula | C23H22OS |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | — |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)C(=O)[C@]21SC12c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C23H22OS/c1-20(2)18-12-13-21(20,3)19(24)23(18)22(25-23)16-10-6-4-8-14(16)15-9-5-7-11-17(15)22/h4-11,18H,12-13H2,1-3H3/t18-,21-,23+/m0/s1 |
| InChIKey | DPGNYEMELRJMAD-AVCGJXAMSA-N |
| XLogP | 5.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 101383861 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101383861?
The IUPAC name of CID 101383861 (CID 101383861) is not available.
What is the SMILES notation for CID 101383861?
The canonical SMILES for CID 101383861 is CC1(C)[C@@H]2CC[C@@]1(C)C(=O)[C@]21SC12c1ccccc1-c1ccccc12.
What is the InChIKey of CID 101383861?
The InChIKey is DPGNYEMELRJMAD-AVCGJXAMSA-N. The full InChI is InChI=1S/C23H22OS/c1-20(2)18-12-13-21(20,3)19(24)23(18)22(25-23)16-10-6-4-8-14(16)15-9-5-7-11-17(15)22/h4-11,18H,12-13H2,1-3H3/t18-,21-,23+/m0/s1.
What are the key properties of CID 101383861?
CID 101383861 has a molecular weight of 346.49 g/mol, XLogP of 5.42, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101383861 is sourced from PubChem (CID 101383861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).