About [1-[2-(1,3-thiazol-2-yl)naphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate
[1-[2-(1,3-thiazol-2-yl)naphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 101384021) has the molecular formula C24H14F3NO3S2
and a molecular weight of 485.51 g/mol. Its IUPAC name is [1-[2-(1,3-thiazol-2-yl)naphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [1-[2-(1,3-thiazol-2-yl)naphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate |
| PubChem CID | 101384021 |
| Molecular Formula | C24H14F3NO3S2 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | [1-[2-(1,3-thiazol-2-yl)naphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2ccccc2c1-c1c(-c2nccs2)ccc2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C24H14F3NO3S2/c25-24(26,27)33(29,30)31-20-12-10-16-6-2-4-8-18(16)22(20)21-17-7-3-1-5-15(17)9-11-19(21)23-28-13-14-32-23/h1-14H |
| InChIKey | QFUVKBPVAPVISC-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [1-[2-(1,3-thiazol-2-yl)naphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2-(1,3-thiazol-2-yl)naphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate?
The IUPAC name of [1-[2-(1,3-thiazol-2-yl)naphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate (CID 101384021) is [1-[2-(1,3-thiazol-2-yl)naphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate.
What is the SMILES notation for [1-[2-(1,3-thiazol-2-yl)naphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate?
The canonical SMILES for [1-[2-(1,3-thiazol-2-yl)naphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate is O=S(=O)(Oc1ccc2ccccc2c1-c1c(-c2nccs2)ccc2ccccc12)C(F)(F)F.
What is the InChIKey of [1-[2-(1,3-thiazol-2-yl)naphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate?
The InChIKey is QFUVKBPVAPVISC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14F3NO3S2/c25-24(26,27)33(29,30)31-20-12-10-16-6-2-4-8-18(16)22(20)21-17-7-3-1-5-15(17)9-11-19(21)23-28-13-14-32-23/h1-14H.
What are the key properties of [1-[2-(1,3-thiazol-2-yl)naphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate?
[1-[2-(1,3-thiazol-2-yl)naphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate has a molecular weight of 485.51 g/mol, XLogP of 7.01, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2-(1,3-thiazol-2-yl)naphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate is sourced from PubChem (CID 101384021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).