C16H22N2S — CID 101384625
(7aS)-3,3-dimethyl-2-[(1S)-1-phenylethyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1-thione (PubChem CID 101384625) has the molecular formula C16H22N2S and a molecular weight of 274.43 g/mol. Its IUPAC name is (7aS)-3,3-dimethyl-2-[(1S)-1-phenylethyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1-thione.
| Compound Name | (7aS)-3,3-dimethyl-2-[(1S)-1-phenylethyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1-thione |
|---|---|
| PubChem CID | 101384625 |
| Molecular Formula | C16H22N2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | (7aS)-3,3-dimethyl-2-[(1S)-1-phenylethyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1-thione |
| SMILES | C[C@@H](c1ccccc1)N1C(=S)[C@@H]2CCCN2C1(C)C |
| InChI | InChI=1S/C16H22N2S/c1-12(13-8-5-4-6-9-13)18-15(19)14-10-7-11-17(14)16(18,2)3/h4-6,8-9,12,14H,7,10-11H2,1-3H3/t12-,14-/m0/s1 |
| InChIKey | DFAQUVMTQZPVTN-JSGCOSHPSA-N |
| XLogP | 3.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|